About diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate
diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate (PubChem CID 54379659) has the molecular formula C18H20O6S
and a molecular weight of 364.42 g/mol. Its IUPAC name is diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate.
Molecular Properties
| Compound Name | diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate |
| PubChem CID | 54379659 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate |
| SMILES | CCOC(=O)C(=CC=C(Sc1ccccc1)C(=O)OCC)OC(C)=O |
| InChI | InChI=1S/C18H20O6S/c1-4-22-17(20)15(24-13(3)19)11-12-16(18(21)23-5-2)25-14-9-7-6-8-10-14/h6-12H,4-5H2,1-3H3 |
| InChIKey | UZAIWBBRMMVIOT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate?
The IUPAC name of diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate (CID 54379659) is diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate.
What is the SMILES notation for diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate?
The canonical SMILES for diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate is CCOC(=O)C(=CC=C(Sc1ccccc1)C(=O)OCC)OC(C)=O.
What is the InChIKey of diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate?
The InChIKey is UZAIWBBRMMVIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O6S/c1-4-22-17(20)15(24-13(3)19)11-12-16(18(21)23-5-2)25-14-9-7-6-8-10-14/h6-12H,4-5H2,1-3H3.
What are the key properties of diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate?
diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate has a molecular weight of 364.42 g/mol, XLogP of 3.24, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-acetyloxy-5-phenylsulfanylhexa-2,4-dienedioate is sourced from PubChem (CID 54379659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).