1-propylcyclopropane-1-carbonyl chloride

C7H11ClO — CID 54379663

IUPAC1-propylcyclopropane-1-carbonyl chloride
SMILESCCCC1(C(=O)Cl)CC1
InChIInChI=1S/C7H11ClO/c1-2-3-7(4-5-7)6(8)9/h2-5H2,1H3
InChIKeyUZAKPXJJDCKZQU-UHFFFAOYSA-N
MW146.62 g/mol
LogP2.33
Rot. Bonds3

About 1-propylcyclopropane-1-carbonyl chloride

1-propylcyclopropane-1-carbonyl chloride (PubChem CID 54379663) has the molecular formula C7H11ClO and a molecular weight of 146.62 g/mol. Its IUPAC name is 1-propylcyclopropane-1-carbonyl chloride.

Molecular Properties

Compound Name1-propylcyclopropane-1-carbonyl chloride
PubChem CID54379663
Molecular FormulaC7H11ClO
Molecular Weight146.62 g/mol
Exact Mass146.05
IUPAC Name1-propylcyclopropane-1-carbonyl chloride
SMILESCCCC1(C(=O)Cl)CC1
InChIInChI=1S/C7H11ClO/c1-2-3-7(4-5-7)6(8)9/h2-5H2,1H3
InChIKeyUZAKPXJJDCKZQU-UHFFFAOYSA-N
XLogP2.33
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.62
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-propylcyclopropane-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-propylcyclopropane-1-carbonyl chloride?
The IUPAC name of 1-propylcyclopropane-1-carbonyl chloride (CID 54379663) is 1-propylcyclopropane-1-carbonyl chloride.
What is the SMILES notation for 1-propylcyclopropane-1-carbonyl chloride?
The canonical SMILES for 1-propylcyclopropane-1-carbonyl chloride is CCCC1(C(=O)Cl)CC1.
What is the InChIKey of 1-propylcyclopropane-1-carbonyl chloride?
The InChIKey is UZAKPXJJDCKZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO/c1-2-3-7(4-5-7)6(8)9/h2-5H2,1H3.
What are the key properties of 1-propylcyclopropane-1-carbonyl chloride?
1-propylcyclopropane-1-carbonyl chloride has a molecular weight of 146.62 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylcyclopropane-1-carbonyl chloride is sourced from PubChem (CID 54379663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).