About 3-methylnon-4-ene
3-methylnon-4-ene (PubChem CID 543797) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is 3-methylnon-4-ene.
Molecular Properties
| Compound Name | 3-methylnon-4-ene |
| PubChem CID | 543797 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | 3-methylnon-4-ene |
| SMILES | CCCCC=CC(C)CC |
| InChI | InChI=1S/C10H20/c1-4-6-7-8-9-10(3)5-2/h8-10H,4-7H2,1-3H3 |
| InChIKey | ZTKHMNVIURCTGG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylnon-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylnon-4-ene?
The IUPAC name of 3-methylnon-4-ene (CID 543797) is 3-methylnon-4-ene.
What is the SMILES notation for 3-methylnon-4-ene?
The canonical SMILES for 3-methylnon-4-ene is CCCCC=CC(C)CC.
What is the InChIKey of 3-methylnon-4-ene?
The InChIKey is ZTKHMNVIURCTGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20/c1-4-6-7-8-9-10(3)5-2/h8-10H,4-7H2,1-3H3.
What are the key properties of 3-methylnon-4-ene?
3-methylnon-4-ene has a molecular weight of 140.27 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylnon-4-ene is sourced from PubChem (CID 543797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).