C24H23N5O2S — CID 54379705
N-[6-[(4-aminoquinazolin-2-yl)amino]hex-3-ynyl]naphthalene-1-sulfonamide (PubChem CID 54379705) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[6-[(4-aminoquinazolin-2-yl)amino]hex-3-ynyl]naphthalene-1-sulfonamide.
| Compound Name | N-[6-[(4-aminoquinazolin-2-yl)amino]hex-3-ynyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 54379705 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[6-[(4-aminoquinazolin-2-yl)amino]hex-3-ynyl]naphthalene-1-sulfonamide |
| SMILES | Nc1nc(NCCC#CCCNS(=O)(=O)c2cccc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C24H23N5O2S/c25-23-20-13-5-6-14-21(20)28-24(29-23)26-16-7-1-2-8-17-27-32(30,31)22-15-9-11-18-10-3-4-12-19(18)22/h3-6,9-15,27H,7-8,16-17H2,(H3,25,26,28,29) |
| InChIKey | UZBCFQXJIATIPJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|