About 1-(2-methylpropyl)pyrrole-2,3,5-triol
1-(2-methylpropyl)pyrrole-2,3,5-triol (PubChem CID 54379815) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(2-methylpropyl)pyrrole-2,3,5-triol.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)pyrrole-2,3,5-triol |
| PubChem CID | 54379815 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1-(2-methylpropyl)pyrrole-2,3,5-triol |
| SMILES | CC(C)Cn1c(O)cc(O)c1O |
| InChI | InChI=1S/C8H13NO3/c1-5(2)4-9-7(11)3-6(10)8(9)12/h3,5,10-12H,4H2,1-2H3 |
| InChIKey | UZCXZXBGOJOMJU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methylpropyl)pyrrole-2,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)pyrrole-2,3,5-triol?
The IUPAC name of 1-(2-methylpropyl)pyrrole-2,3,5-triol (CID 54379815) is 1-(2-methylpropyl)pyrrole-2,3,5-triol.
What is the SMILES notation for 1-(2-methylpropyl)pyrrole-2,3,5-triol?
The canonical SMILES for 1-(2-methylpropyl)pyrrole-2,3,5-triol is CC(C)Cn1c(O)cc(O)c1O.
What is the InChIKey of 1-(2-methylpropyl)pyrrole-2,3,5-triol?
The InChIKey is UZCXZXBGOJOMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-5(2)4-9-7(11)3-6(10)8(9)12/h3,5,10-12H,4H2,1-2H3.
What are the key properties of 1-(2-methylpropyl)pyrrole-2,3,5-triol?
1-(2-methylpropyl)pyrrole-2,3,5-triol has a molecular weight of 171.20 g/mol, XLogP of 1.26, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)pyrrole-2,3,5-triol is sourced from PubChem (CID 54379815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).