About diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate
diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate (PubChem CID 54379868) has the molecular formula C16H17N3O6S
and a molecular weight of 379.39 g/mol. Its IUPAC name is diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate |
| PubChem CID | 54379868 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)sc2c1C(=[N+]=[N-])C(C(=O)OCC)=N2 |
| InChI | InChI=1S/C16H17N3O6S/c1-4-23-9(20)7-8-10-11(19-17)12(15(21)24-5-2)18-14(10)26-13(8)16(22)25-6-3/h4-7H2,1-3H3 |
| InChIKey | UZDTXABVOIIREX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 127.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate?
The IUPAC name of diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate (CID 54379868) is diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate.
What is the SMILES notation for diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate?
The canonical SMILES for diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate is CCOC(=O)Cc1c(C(=O)OCC)sc2c1C(=[N+]=[N-])C(C(=O)OCC)=N2.
What is the InChIKey of diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate?
The InChIKey is UZDTXABVOIIREX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O6S/c1-4-23-9(20)7-8-10-11(19-17)12(15(21)24-5-2)18-14(10)26-13(8)16(22)25-6-3/h4-7H2,1-3H3.
What are the key properties of diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate?
diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate has a molecular weight of 379.39 g/mol, XLogP of 1.70, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-diazo-3-(2-ethoxy-2-oxoethyl)thieno[2,3-b]pyrrole-2,5-dicarboxylate is sourced from PubChem (CID 54379868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).