About N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide
N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide (PubChem CID 54380321) has the molecular formula C22H22NOP
and a molecular weight of 347.40 g/mol. Its IUPAC name is N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide.
Molecular Properties
| Compound Name | N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide |
| PubChem CID | 54380321 |
| Molecular Formula | C22H22NOP |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide |
| SMILES | CCNC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22NOP/c1-2-23-22(24)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,2H2,1H3,(H,23,24) |
| InChIKey | UZKVSNFSCLANRE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The IUPAC name of N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide (CID 54380321) is N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide.
What is the SMILES notation for N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The canonical SMILES for N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide is CCNC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The InChIKey is UZKVSNFSCLANRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22NOP/c1-2-23-22(24)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,2H2,1H3,(H,23,24).
What are the key properties of N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide has a molecular weight of 347.40 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(triphenyl-λ5-phosphanylidene)acetamide is sourced from PubChem (CID 54380321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).