C17H33N — CID 54380899
5-hept-1-enyl-N,N,2,4-tetramethylcyclohexan-1-amine (PubChem CID 54380899) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 5-hept-1-enyl-N,N,2,4-tetramethylcyclohexan-1-amine.
| Compound Name | 5-hept-1-enyl-N,N,2,4-tetramethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 54380899 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 5-hept-1-enyl-N,N,2,4-tetramethylcyclohexan-1-amine |
| SMILES | CCCCCC=CC1CC(N(C)C)C(C)CC1C |
| InChI | InChI=1S/C17H33N/c1-6-7-8-9-10-11-16-13-17(18(4)5)15(3)12-14(16)2/h10-11,14-17H,6-9,12-13H2,1-5H3 |
| InChIKey | UZUZBPCJCVXVGL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|