C11H10F13NO2 — CID 543811
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(4-hydroxybutyl)heptanamide (PubChem CID 543811) has the molecular formula C11H10F13NO2 and a molecular weight of 435.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(4-hydroxybutyl)heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(4-hydroxybutyl)heptanamide |
|---|---|
| PubChem CID | 543811 |
| Molecular Formula | C11H10F13NO2 |
| Molecular Weight | 435.18 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(4-hydroxybutyl)heptanamide |
| SMILES | O=C(NCCCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F13NO2/c12-6(13,5(27)25-3-1-2-4-26)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h26H,1-4H2,(H,25,27) |
| InChIKey | DKFWODRQHYQJGM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|