C23H34ClNO3 — CID 54381320
(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(chloromethyl)benzoate (PubChem CID 54381320) has the molecular formula C23H34ClNO3 and a molecular weight of 407.98 g/mol. Its IUPAC name is (1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(chloromethyl)benzoate.
| Compound Name | (1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 54381320 |
| Molecular Formula | C23H34ClNO3 |
| Molecular Weight | 407.98 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-(chloromethyl)benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(CCl)cc2)CC(C)(C)N1OC1CCCCC1 |
| InChI | InChI=1S/C23H34ClNO3/c1-22(2)14-20(27-21(26)18-12-10-17(16-24)11-13-18)15-23(3,4)25(22)28-19-8-6-5-7-9-19/h10-13,19-20H,5-9,14-16H2,1-4H3 |
| InChIKey | VACKONHFKHCVTA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.98 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|