C22H26N4O4S — CID 54381467
4-[[2-hydroxy-3-[(6-methoxynaphthalen-2-yl)sulfonyl-methylamino]propyl]amino]benzenecarboximidamide (PubChem CID 54381467) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-[(6-methoxynaphthalen-2-yl)sulfonyl-methylamino]propyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-hydroxy-3-[(6-methoxynaphthalen-2-yl)sulfonyl-methylamino]propyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 54381467 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[[2-hydroxy-3-[(6-methoxynaphthalen-2-yl)sulfonyl-methylamino]propyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC(O)CN(C)S(=O)(=O)c2ccc3cc(OC)ccc3c2)cc1 |
| InChI | InChI=1S/C22H26N4O4S/c1-26(14-19(27)13-25-18-7-3-15(4-8-18)22(23)24)31(28,29)21-10-6-16-11-20(30-2)9-5-17(16)12-21/h3-12,19,25,27H,13-14H2,1-2H3,(H3,23,24) |
| InChIKey | VAFDFOWVRWKPEY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|