About N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide
N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide (PubChem CID 54381874) has the molecular formula C15H18N2O3S
and a molecular weight of 306.39 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide |
| PubChem CID | 54381874 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide |
| SMILES | O=C(C=C1NS(=O)(=O)c2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C15H18N2O3S/c18-15(16-11-6-2-1-3-7-11)10-13-12-8-4-5-9-14(12)21(19,20)17-13/h4-5,8-11,17H,1-3,6-7H2,(H,16,18) |
| InChIKey | VAMGIOLWVMALLT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide?
The IUPAC name of N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide (CID 54381874) is N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide.
What is the SMILES notation for N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide?
The canonical SMILES for N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide is O=C(C=C1NS(=O)(=O)c2ccccc21)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide?
The InChIKey is VAMGIOLWVMALLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S/c18-15(16-11-6-2-1-3-7-11)10-13-12-8-4-5-9-14(12)21(19,20)17-13/h4-5,8-11,17H,1-3,6-7H2,(H,16,18).
What are the key properties of N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide?
N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide has a molecular weight of 306.39 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-(1,1-dioxo-1,2-benzothiazol-3-ylidene)acetamide is sourced from PubChem (CID 54381874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).