About 1-pentylpyrrole-2,5-diol
1-pentylpyrrole-2,5-diol (PubChem CID 54382624) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 1-pentylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-pentylpyrrole-2,5-diol |
| PubChem CID | 54382624 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-pentylpyrrole-2,5-diol |
| SMILES | CCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C9H15NO2/c1-2-3-4-7-10-8(11)5-6-9(10)12/h5-6,11-12H,2-4,7H2,1H3 |
| InChIKey | VAZOOHOOIJYBED-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylpyrrole-2,5-diol?
The IUPAC name of 1-pentylpyrrole-2,5-diol (CID 54382624) is 1-pentylpyrrole-2,5-diol.
What is the SMILES notation for 1-pentylpyrrole-2,5-diol?
The canonical SMILES for 1-pentylpyrrole-2,5-diol is CCCCCn1c(O)ccc1O.
What is the InChIKey of 1-pentylpyrrole-2,5-diol?
The InChIKey is VAZOOHOOIJYBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-2-3-4-7-10-8(11)5-6-9(10)12/h5-6,11-12H,2-4,7H2,1H3.
What are the key properties of 1-pentylpyrrole-2,5-diol?
1-pentylpyrrole-2,5-diol has a molecular weight of 169.22 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylpyrrole-2,5-diol is sourced from PubChem (CID 54382624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).