C15H23F3N2O4S — CID 54382683
(2S)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54382683) has the molecular formula C15H23F3N2O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is (2S)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54382683 |
| Molecular Formula | C15H23F3N2O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (2S)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC[C@H](N)C(=O)SCC(C(=O)N1CCC[C@H]1C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O4S/c1-2-3-5-10(19)14(24)25-8-9(15(16,17)18)12(21)20-7-4-6-11(20)13(22)23/h9-11H,2-8,19H2,1H3,(H,22,23)/t9?,10-,11-/m0/s1 |
| InChIKey | VBAWOVYCPHUAFV-DVRYWGNFSA-N |
| XLogP | 2.02 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|