C20H11F15O2 — CID 54382893
4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]phenol (PubChem CID 54382893) has the molecular formula C20H11F15O2 and a molecular weight of 568.28 g/mol. Its IUPAC name is 4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]phenol.
| Compound Name | 4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]phenol |
|---|---|
| PubChem CID | 54382893 |
| Molecular Formula | C20H11F15O2 |
| Molecular Weight | 568.28 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | 4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]phenol |
| SMILES | Oc1ccc(-c2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H11F15O2/c21-14(22,9-37-13-7-3-11(4-8-13)10-1-5-12(36)6-2-10)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h1-8,36H,9H2 |
| InChIKey | VBESAEHQCZAFGG-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.28 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|