About 2-methyl-4-pentylthiane 1,1-dioxide
2-methyl-4-pentylthiane 1,1-dioxide (PubChem CID 543830) has the molecular formula C11H22O2S
and a molecular weight of 218.36 g/mol. Its IUPAC name is 2-methyl-4-pentylthiane 1,1-dioxide.
Molecular Properties
| Compound Name | 2-methyl-4-pentylthiane 1,1-dioxide |
| PubChem CID | 543830 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-methyl-4-pentylthiane 1,1-dioxide |
| SMILES | CCCCCC1CCS(=O)(=O)C(C)C1 |
| InChI | InChI=1S/C11H22O2S/c1-3-4-5-6-11-7-8-14(12,13)10(2)9-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | YQIYUFDLPHPEEO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-pentylthiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-pentylthiane 1,1-dioxide?
The IUPAC name of 2-methyl-4-pentylthiane 1,1-dioxide (CID 543830) is 2-methyl-4-pentylthiane 1,1-dioxide.
What is the SMILES notation for 2-methyl-4-pentylthiane 1,1-dioxide?
The canonical SMILES for 2-methyl-4-pentylthiane 1,1-dioxide is CCCCCC1CCS(=O)(=O)C(C)C1.
What is the InChIKey of 2-methyl-4-pentylthiane 1,1-dioxide?
The InChIKey is YQIYUFDLPHPEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2S/c1-3-4-5-6-11-7-8-14(12,13)10(2)9-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 2-methyl-4-pentylthiane 1,1-dioxide?
2-methyl-4-pentylthiane 1,1-dioxide has a molecular weight of 218.36 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-pentylthiane 1,1-dioxide is sourced from PubChem (CID 543830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).