C17H17NO8 — CID 54383146
(2,3-dihydroxy-7,8-dimethoxy-6,9-dioxo-2,3-dihydro-1H-cyclopenta[a]naphthalen-4-yl)methyl carbamate (PubChem CID 54383146) has the molecular formula C17H17NO8 and a molecular weight of 363.32 g/mol. Its IUPAC name is (2,3-dihydroxy-7,8-dimethoxy-6,9-dioxo-2,3-dihydro-1H-cyclopenta[a]naphthalen-4-yl)methyl carbamate.
| Compound Name | (2,3-dihydroxy-7,8-dimethoxy-6,9-dioxo-2,3-dihydro-1H-cyclopenta[a]naphthalen-4-yl)methyl carbamate |
|---|---|
| PubChem CID | 54383146 |
| Molecular Formula | C17H17NO8 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2,3-dihydroxy-7,8-dimethoxy-6,9-dioxo-2,3-dihydro-1H-cyclopenta[a]naphthalen-4-yl)methyl carbamate |
| SMILES | COC1=C(OC)C(=O)c2c(cc(COC(N)=O)c3c2CC(O)C3O)C1=O |
| InChI | InChI=1S/C17H17NO8/c1-24-15-12(20)8-3-6(5-26-17(18)23)10-7(4-9(19)13(10)21)11(8)14(22)16(15)25-2/h3,9,13,19,21H,4-5H2,1-2H3,(H2,18,23) |
| InChIKey | VBIZJGXXGYBCCA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|