C44H45ClFNO10 — CID 54383466
[(3S,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-2-(fluoromethyl)-4-[[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-3-yl] acetate (PubChem CID 54383466) has the molecular formula C44H45ClFNO10 and a molecular weight of 802.29 g/mol. Its IUPAC name is [(3S,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-2-(fluoromethyl)-4-[[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-3-yl] acetate.
| Compound Name | [(3S,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-2-(fluoromethyl)-4-[[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 54383466 |
| Molecular Formula | C44H45ClFNO10 |
| Molecular Weight | 802.29 g/mol |
| Exact Mass | 801.27 |
| IUPAC Name | [(3S,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-2-(fluoromethyl)-4-[[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(CF)O[C@@H](Cl)C(N2C(=O)c3ccccc3C2=O)C1OC[C@@H]1OC(C)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C44H45ClFNO10/c1-27-37(51-23-29-14-6-3-7-15-29)41(53-25-31-18-10-5-11-19-31)38(52-24-30-16-8-4-9-17-30)35(55-27)26-54-40-36(42(45)57-34(22-46)39(40)56-28(2)48)47-43(49)32-20-12-13-21-33(32)44(47)50/h3-21,27,34-42H,22-26H2,1-2H3/t27?,34?,35-,36?,37+,38?,39+,40?,41?,42+/m0/s1 |
| InChIKey | VBOSLVXVKXSMBU-CKIQHUKUSA-N |
| XLogP | 6.44 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.29 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|