C15H11Cl2N3O3 — CID 5438350
N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-4-nitrobenzamide (PubChem CID 5438350) has the molecular formula C15H11Cl2N3O3 and a molecular weight of 352.18 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5438350 |
| Molecular Formula | C15H11Cl2N3O3 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-4-nitrobenzamide |
| SMILES | C/C(=N/NC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N3O3/c1-9(11-4-7-13(16)14(17)8-11)18-19-15(21)10-2-5-12(6-3-10)20(22)23/h2-8H,1H3,(H,19,21)/b18-9- |
| InChIKey | PESAIEMRZJNNFL-NVMNQCDNSA-N |
| XLogP | 4.06 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|