About 4-ethylhexane-1,5-diol
4-ethylhexane-1,5-diol (PubChem CID 54383708) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is 4-ethylhexane-1,5-diol.
Molecular Properties
| Compound Name | 4-ethylhexane-1,5-diol |
| PubChem CID | 54383708 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 4-ethylhexane-1,5-diol |
| SMILES | CCC(CCCO)C(C)O |
| InChI | InChI=1S/C8H18O2/c1-3-8(7(2)10)5-4-6-9/h7-10H,3-6H2,1-2H3 |
| InChIKey | XFRSHJSIVZJQDL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylhexane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylhexane-1,5-diol?
The IUPAC name of 4-ethylhexane-1,5-diol (CID 54383708) is 4-ethylhexane-1,5-diol.
What is the SMILES notation for 4-ethylhexane-1,5-diol?
The canonical SMILES for 4-ethylhexane-1,5-diol is CCC(CCCO)C(C)O.
What is the InChIKey of 4-ethylhexane-1,5-diol?
The InChIKey is XFRSHJSIVZJQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2/c1-3-8(7(2)10)5-4-6-9/h7-10H,3-6H2,1-2H3.
What are the key properties of 4-ethylhexane-1,5-diol?
4-ethylhexane-1,5-diol has a molecular weight of 146.23 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylhexane-1,5-diol is sourced from PubChem (CID 54383708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).