C16H25NO6 — CID 54383719
3-ethoxy-2-[[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]methyl]-3-oxopropanoic acid (PubChem CID 54383719) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-ethoxy-2-[[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]methyl]-3-oxopropanoic acid.
| Compound Name | 3-ethoxy-2-[[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 54383719 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-ethoxy-2-[[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]methyl]-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(C[C@H]1C=C[C@@H](NC(=O)OC(C)(C)C)C1)C(=O)O |
| InChI | InChI=1S/C16H25NO6/c1-5-22-14(20)12(13(18)19)9-10-6-7-11(8-10)17-15(21)23-16(2,3)4/h6-7,10-12H,5,8-9H2,1-4H3,(H,17,21)(H,18,19)/t10-,11+,12?/m0/s1 |
| InChIKey | VBTKEAADLLVOSL-WIKAKEFZSA-N |
| XLogP | 2.11 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|