About methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate
methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 54383853) has the molecular formula C15H16N2O6
and a molecular weight of 320.30 g/mol. Its IUPAC name is methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate |
| PubChem CID | 54383853 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H16N2O6/c1-22-14(20)11(9-10-5-3-2-4-6-10)16-15(21)23-17-12(18)7-8-13(17)19/h2-8,11,18-19H,9H2,1H3,(H,16,21)/t11-/m1/s1 |
| InChIKey | VBVUZWUOZPBZNI-LLVKDONJSA-N |
| XLogP | 0.82 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate?
The IUPAC name of methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate (CID 54383853) is methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate.
What is the SMILES notation for methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate?
The canonical SMILES for methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate is COC(=O)[C@@H](Cc1ccccc1)NC(=O)On1c(O)ccc1O.
What is the InChIKey of methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate?
The InChIKey is VBVUZWUOZPBZNI-LLVKDONJSA-N. The full InChI is InChI=1S/C15H16N2O6/c1-22-14(20)11(9-10-5-3-2-4-6-10)16-15(21)23-17-12(18)7-8-13(17)19/h2-8,11,18-19H,9H2,1H3,(H,16,21)/t11-/m1/s1.
What are the key properties of methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate?
methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate has a molecular weight of 320.30 g/mol, XLogP of 0.82, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]-3-phenylpropanoate is sourced from PubChem (CID 54383853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).