C7H13ClF4OSi — CID 54384040
chloro-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-dimethylsilane (PubChem CID 54384040) has the molecular formula C7H13ClF4OSi and a molecular weight of 252.71 g/mol. Its IUPAC name is chloro-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-dimethylsilane.
| Compound Name | chloro-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-dimethylsilane |
|---|---|
| PubChem CID | 54384040 |
| Molecular Formula | C7H13ClF4OSi |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | chloro-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-dimethylsilane |
| SMILES | CCOCC(F)(F)C(F)(F)[Si](C)(C)Cl |
| InChI | InChI=1S/C7H13ClF4OSi/c1-4-13-5-6(9,10)7(11,12)14(2,3)8/h4-5H2,1-3H3 |
| InChIKey | VBZBLNDLUOCCTG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|