C31H24F4Si — CID 54384091
2,5-bis(3,4-difluorophenyl)-1-ethyl-1-methyl-3,4-diphenylsilole (PubChem CID 54384091) has the molecular formula C31H24F4Si and a molecular weight of 500.61 g/mol. Its IUPAC name is 2,5-bis(3,4-difluorophenyl)-1-ethyl-1-methyl-3,4-diphenylsilole.
| Compound Name | 2,5-bis(3,4-difluorophenyl)-1-ethyl-1-methyl-3,4-diphenylsilole |
|---|---|
| PubChem CID | 54384091 |
| Molecular Formula | C31H24F4Si |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2,5-bis(3,4-difluorophenyl)-1-ethyl-1-methyl-3,4-diphenylsilole |
| SMILES | CC[Si]1(C)C(c2ccc(F)c(F)c2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C31H24F4Si/c1-3-36(2)30(22-14-16-24(32)26(34)18-22)28(20-10-6-4-7-11-20)29(21-12-8-5-9-13-21)31(36)23-15-17-25(33)27(35)19-23/h4-19H,3H2,1-2H3 |
| InChIKey | VBZXAWSZMLAJDJ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|