C12H12F3N3O3 — CID 54384438
1,3,5-tris(3-fluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 54384438) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is 1,3,5-tris(3-fluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(3-fluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54384438 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1,3,5-tris(3-fluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CC=CF)c(=O)n(CC=CF)c(=O)n1CC=CF |
| InChI | InChI=1S/C12H12F3N3O3/c13-4-1-7-16-10(19)17(8-2-5-14)12(21)18(11(16)20)9-3-6-15/h1-6H,7-9H2 |
| InChIKey | VCFVVLVEPYOCCP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |