C34H35N2O4S2+ — CID 54384544
3-[2-[3-ethyl-5-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)pent-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 54384544) has the molecular formula C34H35N2O4S2+ and a molecular weight of 599.80 g/mol. Its IUPAC name is 3-[2-[3-ethyl-5-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)pent-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[3-ethyl-5-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)pent-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54384544 |
| Molecular Formula | C34H35N2O4S2+ |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 3-[2-[3-ethyl-5-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)pent-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(C=Cc1oc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O)CC=C1Sc2ccc3ccccc3c2N1CC |
| InChI | InChI=1S/C34H34N2O4S2/c1-3-24(15-21-32-35(4-2)34-28-13-8-6-11-26(28)17-19-30(34)41-32)14-20-31-36(22-9-23-42(37,38)39)33-27-12-7-5-10-25(27)16-18-29(33)40-31/h5-8,10-14,16-21,24H,3-4,9,15,22-23H2,1-2H3/p+1 |
| InChIKey | VCHNLACHOTWJHO-UHFFFAOYSA-O |
| XLogP | 8.21 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|