C22H28F4O5S — CID 54384992
7-[(2R)-3-hydroxy-2-[3-hydroxy-4-(2,3,5,6-tetrafluorophenyl)sulfanylbutyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 54384992) has the molecular formula C22H28F4O5S and a molecular weight of 480.52 g/mol. Its IUPAC name is 7-[(2R)-3-hydroxy-2-[3-hydroxy-4-(2,3,5,6-tetrafluorophenyl)sulfanylbutyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(2R)-3-hydroxy-2-[3-hydroxy-4-(2,3,5,6-tetrafluorophenyl)sulfanylbutyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54384992 |
| Molecular Formula | C22H28F4O5S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 7-[(2R)-3-hydroxy-2-[3-hydroxy-4-(2,3,5,6-tetrafluorophenyl)sulfanylbutyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CC(O)[C@@H]1CCC(O)CSc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C22H28F4O5S/c23-15-9-16(24)21(26)22(20(15)25)32-11-12(27)7-8-14-13(17(28)10-18(14)29)5-3-1-2-4-6-19(30)31/h9,12-14,18,27,29H,1-8,10-11H2,(H,30,31)/t12?,13?,14-,18?/m1/s1 |
| InChIKey | VCOXIIJHEDDGCW-QQJWGNSGSA-N |
| XLogP | 4.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|