C16H20N4O — CID 54385327
[(6aR)-4-methyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea (PubChem CID 54385327) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is [(6aR)-4-methyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea.
| Compound Name | [(6aR)-4-methyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea |
|---|---|
| PubChem CID | 54385327 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(6aR)-4-methyl-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5-yl]urea |
| SMILES | Cn1c(NC(N)=O)c2c3c(cccc31)C1CCCN[C@@H]1C2 |
| InChI | InChI=1S/C16H20N4O/c1-20-13-6-2-4-10-9-5-3-7-18-12(9)8-11(14(10)13)15(20)19-16(17)21/h2,4,6,9,12,18H,3,5,7-8H2,1H3,(H3,17,19,21)/t9?,12-/m1/s1 |
| InChIKey | VCUVDMLYSKZBOF-FFFFSGIJSA-N |
| XLogP | 2.06 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|