About (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one
(6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one (PubChem CID 54385379) has the molecular formula C21H21N3OS
and a molecular weight of 363.49 g/mol. Its IUPAC name is (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one.
Molecular Properties
| Compound Name | (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one |
| PubChem CID | 54385379 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one |
| SMILES | O=C1CCC[C@H](CSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)N1 |
| InChI | InChI=1S/C21H21N3OS/c25-18-13-7-12-17(22-18)14-26-21-23-19(15-8-3-1-4-9-15)20(24-21)16-10-5-2-6-11-16/h1-6,8-11,17H,7,12-14H2,(H,22,25)(H,23,24)/t17-/m1/s1 |
| InChIKey | VCVZGOIXEBRSDB-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one?
The IUPAC name of (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one (CID 54385379) is (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one.
What is the SMILES notation for (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one?
The canonical SMILES for (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one is O=C1CCC[C@H](CSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)N1.
What is the InChIKey of (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one?
The InChIKey is VCVZGOIXEBRSDB-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H21N3OS/c25-18-13-7-12-17(22-18)14-26-21-23-19(15-8-3-1-4-9-15)20(24-21)16-10-5-2-6-11-16/h1-6,8-11,17H,7,12-14H2,(H,22,25)(H,23,24)/t17-/m1/s1.
What are the key properties of (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one?
(6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one has a molecular weight of 363.49 g/mol, XLogP of 4.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]piperidin-2-one is sourced from PubChem (CID 54385379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).