About [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate
[1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate (PubChem CID 54385608) has the molecular formula C18H42O7Si4
and a molecular weight of 482.87 g/mol. Its IUPAC name is [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate |
| PubChem CID | 54385608 |
| Molecular Formula | C18H42O7Si4 |
| Molecular Weight | 482.87 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)CO |
| InChI | InChI=1S/C18H42O7Si4/c1-15(2)18(21)22-17(16(20)14-19)12-13-29(23-26(3,4)5,24-27(6,7)8)25-28(9,10)11/h16-17,19-20H,1,12-14H2,2-11H3 |
| InChIKey | VDAJLWOICUNBQG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate?
The IUPAC name of [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate (CID 54385608) is [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate?
The canonical SMILES for [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(CC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)CO.
What is the InChIKey of [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate?
The InChIKey is VDAJLWOICUNBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42O7Si4/c1-15(2)18(21)22-17(16(20)14-19)12-13-29(23-26(3,4)5,24-27(6,7)8)25-28(9,10)11/h16-17,19-20H,1,12-14H2,2-11H3.
What are the key properties of [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate?
[1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate has a molecular weight of 482.87 g/mol, XLogP of 3.71, 13 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-dihydroxy-5-tris(trimethylsilyloxy)silylpentan-3-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 54385608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).