About 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid)
2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) (PubChem CID 54385695) has the molecular formula C17H19NO2S3
and a molecular weight of 365.55 g/mol. Its IUPAC name is 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid).
Molecular Properties
| Compound Name | 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) |
| PubChem CID | 54385695 |
| Molecular Formula | C17H19NO2S3 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) |
| SMILES | O=C(S)CC(C(=O)S)c1nc2ccc(C3CCCCC3)cc2s1 |
| InChI | InChI=1S/C17H19NO2S3/c19-15(21)9-12(17(20)22)16-18-13-7-6-11(8-14(13)23-16)10-4-2-1-3-5-10/h6-8,10,12H,1-5,9H2,(H,19,21)(H,20,22) |
| InChIKey | VDBUCUSGVZCSFK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid)?
The IUPAC name of 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) (CID 54385695) is 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid).
What is the SMILES notation for 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid)?
The canonical SMILES for 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) is O=C(S)CC(C(=O)S)c1nc2ccc(C3CCCCC3)cc2s1.
What is the InChIKey of 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid)?
The InChIKey is VDBUCUSGVZCSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2S3/c19-15(21)9-12(17(20)22)16-18-13-7-6-11(8-14(13)23-16)10-4-2-1-3-5-10/h6-8,10,12H,1-5,9H2,(H,19,21)(H,20,22).
What are the key properties of 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid)?
2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) has a molecular weight of 365.55 g/mol, XLogP of 4.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-cyclohexyl-1,3-benzothiazol-2-yl)butanebis(thioic S-acid) is sourced from PubChem (CID 54385695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).