C9H16O6 — CID 54385755
(1S,2S,3R,4R,5S,6R)-7,7-dimethylbicyclo[4.1.0]heptane-1,2,3,4,5,6-hexol (PubChem CID 54385755) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (1S,2S,3R,4R,5S,6R)-7,7-dimethylbicyclo[4.1.0]heptane-1,2,3,4,5,6-hexol.
| Compound Name | (1S,2S,3R,4R,5S,6R)-7,7-dimethylbicyclo[4.1.0]heptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 54385755 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (1S,2S,3R,4R,5S,6R)-7,7-dimethylbicyclo[4.1.0]heptane-1,2,3,4,5,6-hexol |
| SMILES | CC1(C)[C@]2(O)[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@]12O |
| InChI | InChI=1S/C9H16O6/c1-7(2)8(14)5(12)3(10)4(11)6(13)9(7,8)15/h3-6,10-15H,1-2H3/t3-,4-,5+,6+,8-,9+/m1/s1 |
| InChIKey | VDCUMUFWPBCXLM-LIMOOSGTSA-N |
| XLogP | -3.05 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |