C22H24N4O2 — CID 54385878
N'-(2-benzylphenyl)-N,N-dimethyl-N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 54385878) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N'-(2-benzylphenyl)-N,N-dimethyl-N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-(2-benzylphenyl)-N,N-dimethyl-N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54385878 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N'-(2-benzylphenyl)-N,N-dimethyl-N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | CN(C)CCN(c1ccccc1Cc1ccccc1)c1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N4O2/c1-24(2)15-16-25(22-21(26(27)28)13-8-14-23-22)20-12-7-6-11-19(20)17-18-9-4-3-5-10-18/h3-14H,15-17H2,1-2H3 |
| InChIKey | WVGMPGRNTBHBNA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|