About 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane
2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane (PubChem CID 54385907) has the molecular formula C10H17BrO2
and a molecular weight of 249.15 g/mol. Its IUPAC name is 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane |
| PubChem CID | 54385907 |
| Molecular Formula | C10H17BrO2 |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane |
| SMILES | CCC=CC1COC(CCBr)OC1 |
| InChI | InChI=1S/C10H17BrO2/c1-2-3-4-9-7-12-10(5-6-11)13-8-9/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | VDFGHUHMXWGHHM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane?
The IUPAC name of 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane (CID 54385907) is 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane.
What is the SMILES notation for 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane?
The canonical SMILES for 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane is CCC=CC1COC(CCBr)OC1.
What is the InChIKey of 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane?
The InChIKey is VDFGHUHMXWGHHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BrO2/c1-2-3-4-9-7-12-10(5-6-11)13-8-9/h3-4,9-10H,2,5-8H2,1H3.
What are the key properties of 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane?
2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane has a molecular weight of 249.15 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromoethyl)-5-but-1-enyl-1,3-dioxane is sourced from PubChem (CID 54385907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).