C9H17N — CID 54386000
ethane;2,3,4-trimethyl-1H-pyrrole (PubChem CID 54386000) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is ethane;2,3,4-trimethyl-1H-pyrrole.
| Compound Name | ethane;2,3,4-trimethyl-1H-pyrrole |
|---|---|
| PubChem CID | 54386000 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | ethane;2,3,4-trimethyl-1H-pyrrole |
| SMILES | CC.Cc1c[nH]c(C)c1C |
| InChI | InChI=1S/C7H11N.C2H6/c1-5-4-8-7(3)6(5)2;1-2/h4,8H,1-3H3;1-2H3 |
| InChIKey | LUQNRWDNYBAHJW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |