About ethylamino nitrate
ethylamino nitrate (PubChem CID 54386330) has the molecular formula C2H6N2O3
and a molecular weight of 106.08 g/mol. Its IUPAC name is ethylamino nitrate.
Molecular Properties
| Compound Name | ethylamino nitrate |
| PubChem CID | 54386330 |
| Molecular Formula | C2H6N2O3 |
| Molecular Weight | 106.08 g/mol |
| Exact Mass | 106.04 |
| IUPAC Name | ethylamino nitrate |
| SMILES | CCNO[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N2O3/c1-2-3-7-4(5)6/h3H,2H2,1H3 |
| InChIKey | VDMUEKQXLWQMEF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.08 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethylamino nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylamino nitrate?
The IUPAC name of ethylamino nitrate (CID 54386330) is ethylamino nitrate.
What is the SMILES notation for ethylamino nitrate?
The canonical SMILES for ethylamino nitrate is CCNO[N+](=O)[O-].
What is the InChIKey of ethylamino nitrate?
The InChIKey is VDMUEKQXLWQMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O3/c1-2-3-7-4(5)6/h3H,2H2,1H3.
What are the key properties of ethylamino nitrate?
ethylamino nitrate has a molecular weight of 106.08 g/mol, XLogP of -0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylamino nitrate is sourced from PubChem (CID 54386330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).