ethylamino nitrate

C2H6N2O3 — CID 54386330

IUPACethylamino nitrate
SMILESCCNO[N+](=O)[O-]
InChIInChI=1S/C2H6N2O3/c1-2-3-7-4(5)6/h3H,2H2,1H3
InChIKeyVDMUEKQXLWQMEF-UHFFFAOYSA-N
MW106.08 g/mol
LogP-0.28
Rot. Bonds3

About ethylamino nitrate

ethylamino nitrate (PubChem CID 54386330) has the molecular formula C2H6N2O3 and a molecular weight of 106.08 g/mol. Its IUPAC name is ethylamino nitrate.

Molecular Properties

Compound Nameethylamino nitrate
PubChem CID54386330
Molecular FormulaC2H6N2O3
Molecular Weight106.08 g/mol
Exact Mass106.04
IUPAC Nameethylamino nitrate
SMILESCCNO[N+](=O)[O-]
InChIInChI=1S/C2H6N2O3/c1-2-3-7-4(5)6/h3H,2H2,1H3
InChIKeyVDMUEKQXLWQMEF-UHFFFAOYSA-N
XLogP-0.28
TPSA64.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500106.08
LogP ≤ 5-0.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethylamino nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethylamino nitrate?
The IUPAC name of ethylamino nitrate (CID 54386330) is ethylamino nitrate.
What is the SMILES notation for ethylamino nitrate?
The canonical SMILES for ethylamino nitrate is CCNO[N+](=O)[O-].
What is the InChIKey of ethylamino nitrate?
The InChIKey is VDMUEKQXLWQMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O3/c1-2-3-7-4(5)6/h3H,2H2,1H3.
What are the key properties of ethylamino nitrate?
ethylamino nitrate has a molecular weight of 106.08 g/mol, XLogP of -0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylamino nitrate is sourced from PubChem (CID 54386330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).