C18H28N2 — CID 54386362
1-(3,7,11-trimethyldodeca-2,6,10-trienyl)imidazole (PubChem CID 54386362) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(3,7,11-trimethyldodeca-2,6,10-trienyl)imidazole.
| Compound Name | 1-(3,7,11-trimethyldodeca-2,6,10-trienyl)imidazole |
|---|---|
| PubChem CID | 54386362 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(3,7,11-trimethyldodeca-2,6,10-trienyl)imidazole |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCn1ccnc1 |
| InChI | InChI=1S/C18H28N2/c1-16(2)7-5-8-17(3)9-6-10-18(4)11-13-20-14-12-19-15-20/h7,9,11-12,14-15H,5-6,8,10,13H2,1-4H3 |
| InChIKey | VDNCQWCKAYFEFE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|