C24H25N3O5 — CID 54386684
3-(1,3-benzodioxol-5-ylmethylidene)-6-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]piperazine-2,5-dione (PubChem CID 54386684) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylidene)-6-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]piperazine-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylidene)-6-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 54386684 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylidene)-6-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]piperazine-2,5-dione |
| SMILES | CN(C)CCCOc1ccc(C=c2[nH]c(=O)c(=Cc3ccc4c(c3)OCO4)[nH]c2=O)cc1 |
| InChI | InChI=1S/C24H25N3O5/c1-27(2)10-3-11-30-18-7-4-16(5-8-18)12-19-23(28)26-20(24(29)25-19)13-17-6-9-21-22(14-17)32-15-31-21/h4-9,12-14H,3,10-11,15H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | VDSNYCVUFWOTRA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|