C26H43NO3 — CID 54386904
4-[(octadeca-9,12,15-trienoylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 54386904) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is 4-[(octadeca-9,12,15-trienoylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(octadeca-9,12,15-trienoylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 54386904 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | 4-[(octadeca-9,12,15-trienoylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C26H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(28)27-22-23-18-20-24(21-19-23)26(29)30/h3-4,6-7,9-10,23-24H,2,5,8,11-22H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | VDWRDUYBXLZKOT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|