About 5-methyl-2,3-dihydropyrrol-1-amine
5-methyl-2,3-dihydropyrrol-1-amine (PubChem CID 54387342) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 5-methyl-2,3-dihydropyrrol-1-amine.
Molecular Properties
| Compound Name | 5-methyl-2,3-dihydropyrrol-1-amine |
| PubChem CID | 54387342 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 5-methyl-2,3-dihydropyrrol-1-amine |
| SMILES | CC1=CCCN1N |
| InChI | InChI=1S/C5H10N2/c1-5-3-2-4-7(5)6/h3H,2,4,6H2,1H3 |
| InChIKey | VEDUPTSLOZGRNP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2,3-dihydropyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dihydropyrrol-1-amine?
The IUPAC name of 5-methyl-2,3-dihydropyrrol-1-amine (CID 54387342) is 5-methyl-2,3-dihydropyrrol-1-amine.
What is the SMILES notation for 5-methyl-2,3-dihydropyrrol-1-amine?
The canonical SMILES for 5-methyl-2,3-dihydropyrrol-1-amine is CC1=CCCN1N.
What is the InChIKey of 5-methyl-2,3-dihydropyrrol-1-amine?
The InChIKey is VEDUPTSLOZGRNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-5-3-2-4-7(5)6/h3H,2,4,6H2,1H3.
What are the key properties of 5-methyl-2,3-dihydropyrrol-1-amine?
5-methyl-2,3-dihydropyrrol-1-amine has a molecular weight of 98.15 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydropyrrol-1-amine is sourced from PubChem (CID 54387342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).