About methyl 8-sulfanyloct-5-enoate
methyl 8-sulfanyloct-5-enoate (PubChem CID 54387770) has the molecular formula C9H16O2S
and a molecular weight of 188.29 g/mol. Its IUPAC name is methyl 8-sulfanyloct-5-enoate.
Molecular Properties
| Compound Name | methyl 8-sulfanyloct-5-enoate |
| PubChem CID | 54387770 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | methyl 8-sulfanyloct-5-enoate |
| SMILES | COC(=O)CCCC=CCCS |
| InChI | InChI=1S/C9H16O2S/c1-11-9(10)7-5-3-2-4-6-8-12/h2,4,12H,3,5-8H2,1H3 |
| InChIKey | VELUNNDITXCJHN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-sulfanyloct-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-sulfanyloct-5-enoate?
The IUPAC name of methyl 8-sulfanyloct-5-enoate (CID 54387770) is methyl 8-sulfanyloct-5-enoate.
What is the SMILES notation for methyl 8-sulfanyloct-5-enoate?
The canonical SMILES for methyl 8-sulfanyloct-5-enoate is COC(=O)CCCC=CCCS.
What is the InChIKey of methyl 8-sulfanyloct-5-enoate?
The InChIKey is VELUNNDITXCJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S/c1-11-9(10)7-5-3-2-4-6-8-12/h2,4,12H,3,5-8H2,1H3.
What are the key properties of methyl 8-sulfanyloct-5-enoate?
methyl 8-sulfanyloct-5-enoate has a molecular weight of 188.29 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-sulfanyloct-5-enoate is sourced from PubChem (CID 54387770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).