About N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide
N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 54387791) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide |
| PubChem CID | 54387791 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1ncc[nH]1 |
| InChI | InChI=1S/C6H10N4/c1-10(2)5-9-6-7-3-4-8-6/h3-5H,1-2H3,(H,7,8) |
| InChIKey | VEMHGBRKKQAHQD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide?
The IUPAC name of N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide (CID 54387791) is N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide is CN(C)C=Nc1ncc[nH]1.
What is the InChIKey of N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide?
The InChIKey is VEMHGBRKKQAHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-10(2)5-9-6-7-3-4-8-6/h3-5H,1-2H3,(H,7,8).
What are the key properties of N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide?
N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide has a molecular weight of 138.17 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1H-imidazol-2-yl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 54387791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).