C32H61N7O8 — CID 54388509
tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butylamino]butan-2-yl]carbamate (PubChem CID 54388509) has the molecular formula C32H61N7O8 and a molecular weight of 671.88 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 54388509 |
| Molecular Formula | C32H61N7O8 |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.46 |
| IUPAC Name | tert-butyl N-[4-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butylamino]butan-2-yl]carbamate |
| SMILES | CC(CCNCCCCNC(=O)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H61N7O8/c1-23(37-27(42)45-30(2,3)4)17-22-33-18-15-16-20-35-25(41)24(40)34-19-13-11-12-14-21-36-26(38-28(43)46-31(5,6)7)39-29(44)47-32(8,9)10/h23,33H,11-22H2,1-10H3,(H,34,40)(H,35,41)(H,37,42)(H2,36,38,39,43,44) |
| InChIKey | VEYOFZGYASWFCS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 197.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|