About 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide
3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide (PubChem CID 54388875) has the molecular formula C16H25N3OS
and a molecular weight of 307.46 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide.
Molecular Properties
| Compound Name | 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide |
| PubChem CID | 54388875 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide |
| SMILES | CC(=NNC(=O)CCC1CCCCC1)c1sc(C)nc1C |
| InChI | InChI=1S/C16H25N3OS/c1-11-16(21-13(3)17-11)12(2)18-19-15(20)10-9-14-7-5-4-6-8-14/h14H,4-10H2,1-3H3,(H,19,20) |
| InChIKey | VFEYOAOPVNSBGK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide?
The IUPAC name of 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide (CID 54388875) is 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide.
What is the SMILES notation for 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide?
The canonical SMILES for 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide is CC(=NNC(=O)CCC1CCCCC1)c1sc(C)nc1C.
What is the InChIKey of 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide?
The InChIKey is VFEYOAOPVNSBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3OS/c1-11-16(21-13(3)17-11)12(2)18-19-15(20)10-9-14-7-5-4-6-8-14/h14H,4-10H2,1-3H3,(H,19,20).
What are the key properties of 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide?
3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide has a molecular weight of 307.46 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylideneamino]propanamide is sourced from PubChem (CID 54388875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).