C20H21FO7S — CID 54389832
[(3aR,5R,6S,6aR)-2-(2-fluorophenyl)-6-hydroxy-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 54389832) has the molecular formula C20H21FO7S and a molecular weight of 424.45 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2-(2-fluorophenyl)-6-hydroxy-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-2-(2-fluorophenyl)-6-hydroxy-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54389832 |
| Molecular Formula | C20H21FO7S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2-(2-fluorophenyl)-6-hydroxy-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H]3OC(C)(c4ccccc4F)O[C@@H]3[C@H]2O)cc1 |
| InChI | InChI=1S/C20H21FO7S/c1-12-7-9-13(10-8-12)29(23,24)25-11-16-17(22)18-19(26-16)28-20(2,27-18)14-5-3-4-6-15(14)21/h3-10,16-19,22H,11H2,1-2H3/t16-,17+,18-,19-,20?/m1/s1 |
| InChIKey | VFVLQPCSYWESPW-XBYSNUDESA-N |
| XLogP | 2.21 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|