About methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate
methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate (PubChem CID 54389907) has the molecular formula C15H18Cl2O2S2
and a molecular weight of 365.35 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate |
| PubChem CID | 54389907 |
| Molecular Formula | C15H18Cl2O2S2 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate |
| SMILES | COC(=O)CS[C@@H]1CCCC[C@H]1Sc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H18Cl2O2S2/c1-19-14(18)9-20-12-7-2-3-8-13(12)21-15-10(16)5-4-6-11(15)17/h4-6,12-13H,2-3,7-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | VFWXIIKYHZYGJW-CHWSQXEVSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate?
The IUPAC name of methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate (CID 54389907) is methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate.
What is the SMILES notation for methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate?
The canonical SMILES for methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate is COC(=O)CS[C@@H]1CCCC[C@H]1Sc1c(Cl)cccc1Cl.
What is the InChIKey of methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate?
The InChIKey is VFWXIIKYHZYGJW-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H18Cl2O2S2/c1-19-14(18)9-20-12-7-2-3-8-13(12)21-15-10(16)5-4-6-11(15)17/h4-6,12-13H,2-3,7-9H2,1H3/t12-,13-/m1/s1.
What are the key properties of methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate?
methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate has a molecular weight of 365.35 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,2R)-2-(2,6-dichlorophenyl)sulfanylcyclohexyl]sulfanylacetate is sourced from PubChem (CID 54389907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).