C30H60N6O2 — CID 54390381
1-[6-[carbamoyl-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]amino]hexyl]-1-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]urea (PubChem CID 54390381) has the molecular formula C30H60N6O2 and a molecular weight of 536.85 g/mol. Its IUPAC name is 1-[6-[carbamoyl-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]amino]hexyl]-1-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]urea.
| Compound Name | 1-[6-[carbamoyl-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]amino]hexyl]-1-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 54390381 |
| Molecular Formula | C30H60N6O2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.48 |
| IUPAC Name | 1-[6-[carbamoyl-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]amino]hexyl]-1-[2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl]urea |
| SMILES | CC1(C)CC(CCN(CCCCCCN(CCC2CC(C)(C)NC(C)(C)C2)C(N)=O)C(N)=O)CC(C)(C)N1 |
| InChI | InChI=1S/C30H60N6O2/c1-27(2)19-23(20-28(3,4)33-27)13-17-35(25(31)37)15-11-9-10-12-16-36(26(32)38)18-14-24-21-29(5,6)34-30(7,8)22-24/h23-24,33-34H,9-22H2,1-8H3,(H2,31,37)(H2,32,38) |
| InChIKey | VGFDVFAZBVVDMW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|