C18H32O3 — CID 54390594
3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2-diol (PubChem CID 54390594) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2-diol.
| Compound Name | 3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 54390594 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2-diol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOCC(O)CO |
| InChI | InChI=1S/C18H32O3/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-21-14-18(20)13-19/h7,9,11,18-20H,5-6,8,10,12-14H2,1-4H3 |
| InChIKey | VGIZXGYRSPTVQF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|