About 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate
1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate (PubChem CID 54391269) has the molecular formula C30H52O8S2
and a molecular weight of 604.87 g/mol. Its IUPAC name is 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate.
Molecular Properties
| Compound Name | 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate |
| PubChem CID | 54391269 |
| Molecular Formula | C30H52O8S2 |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate |
| SMILES | CCCCOC(=O)CC(S)C(=O)OCCCCC1(CCCCOC(=O)C(S)CC(=O)OCCCC)CCCCC1 |
| InChI | InChI=1S/C30H52O8S2/c1-3-5-18-35-26(31)22-24(39)28(33)37-20-12-10-16-30(14-8-7-9-15-30)17-11-13-21-38-29(34)25(40)23-27(32)36-19-6-4-2/h24-25,39-40H,3-23H2,1-2H3 |
| InChIKey | VGUMVEYKKKWBOM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate?
The IUPAC name of 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate (CID 54391269) is 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate.
What is the SMILES notation for 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate?
The canonical SMILES for 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate is CCCCOC(=O)CC(S)C(=O)OCCCCC1(CCCCOC(=O)C(S)CC(=O)OCCCC)CCCCC1.
What is the InChIKey of 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate?
The InChIKey is VGUMVEYKKKWBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H52O8S2/c1-3-5-18-35-26(31)22-24(39)28(33)37-20-12-10-16-30(14-8-7-9-15-30)17-11-13-21-38-29(34)25(40)23-27(32)36-19-6-4-2/h24-25,39-40H,3-23H2,1-2H3.
What are the key properties of 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate?
1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate has a molecular weight of 604.87 g/mol, XLogP of 6.43, 22 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[4-[1-[4-(4-butoxy-4-oxo-2-sulfanylbutanoyl)oxybutyl]cyclohexyl]butyl] 4-O-butyl 2-sulfanylbutanedioate is sourced from PubChem (CID 54391269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).