C15H20F3N3O6S — CID 54391555
[4-[(2-hydroxy-2-methylpropyl)amino]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate (PubChem CID 54391555) has the molecular formula C15H20F3N3O6S and a molecular weight of 427.40 g/mol. Its IUPAC name is [4-[(2-hydroxy-2-methylpropyl)amino]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-[(2-hydroxy-2-methylpropyl)amino]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54391555 |
| Molecular Formula | C15H20F3N3O6S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [4-[(2-hydroxy-2-methylpropyl)amino]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(O)CNc1c2c(nc(OS(=O)(=O)C(F)(F)F)c1[N+](=O)[O-])CCCCC2 |
| InChI | InChI=1S/C15H20F3N3O6S/c1-14(2,22)8-19-11-9-6-4-3-5-7-10(9)20-13(12(11)21(23)24)27-28(25,26)15(16,17)18/h22H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | VGZUCBPWTJEXEZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|